CAS 932162-74-8 is the registry number for 7-(Difluoromethyl)pyrazolo(1,5-a)pyrimidin-5-ol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
7-(difluoromethyl)-4H-pyrazolo[1,5-a]pyrimidin-5-one (CAS 932162-74-8) is a chemical compound with the molecular formula C7H5F2N3O and a molecular weight of 185.13 g/mol. IUPAC name: 7-(difluoromethyl)-4H-pyrazolo[1,5-a]pyrimidin-5-one. InChIKey: BIVSFLOGGTUYFO-UHFFFAOYSA-N.
| Molecular formula | C7H5F2N3O |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 7-(difluoromethyl)-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| InChIKey | BIVSFLOGGTUYFO-UHFFFAOYSA-N |
| SMILES | C1=C2NC(=O)C=C(N2N=C1)C(F)F |
Computed by PubChem (NCBI)