Products 154492-74-7
CAS 154492-74-7 appears in our catalog under these names: Phenoxy-d5-acetic Acid, >95% (HPLC), Phenoxy-d5-acetic Acid, 98 atom % D, min 98% Chemical Purity, Phenoxyacetic acid–d5, Phenoxyacetic acid-d5, 99.51%, D5-Phenoxy acetic acid. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 50mg, 5mg, 0,25g, 0,1g, 1mg, 10mg, 25 mg, 5 mg.
2-(2,3,4,5,6-pentadeuteriophenoxy)acetic acid (CAS 154492-74-7) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 157.18 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriophenoxy)acetic acid. InChIKey: LCPDWSOZIOUXRV-RALIUCGRSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 157.18 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriophenoxy)acetic acid |
| InChIKey | LCPDWSOZIOUXRV-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)