CAS 154495-66-6 appears in our catalog under these names: (1-Benzyl-4-nitromethyl-piperidin-4-yl)-acetic acid ethyl ester, 90%, Ethyl 2-(1-benzyl-4-(nitromethyl)piperidin-4-yl)acetate, 97%, Ethyl 2–(1–benzyl–4–(nitromethyl)piperidin–4–yl)acetate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 2-[1-benzyl-4-(nitromethyl)piperidin-4-yl]acetate (CAS 154495-66-6) is a chemical compound with the molecular formula C17H24N2O4 and a molecular weight of 320.4 g/mol. IUPAC name: ethyl 2-[1-benzyl-4-(nitromethyl)piperidin-4-yl]acetate. InChIKey: HQJUZODKTPHDAG-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O4 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | ethyl 2-[1-benzyl-4-(nitromethyl)piperidin-4-yl]acetate |
| InChIKey | HQJUZODKTPHDAG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(CCN(CC1)CC2=CC=CC=C2)C[N+](=O)[O-] |
Computed by PubChem (NCBI)