Products 1545675-72-6

CAS 1545675-72-6 is the registry number for 5-Chloroimidazo[1,5-a]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloroimidazo[1,5-a]pyridine-3-carboxylic acid (CAS 1545675-72-6) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 5-chloroimidazo[1,5-a]pyridine-3-carboxylic acid. InChIKey: MPGSLMZRYLACIA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClN2O2
Molecular weight196.59 g/mol
IUPAC name5-chloroimidazo[1,5-a]pyridine-3-carboxylic acid
InChIKeyMPGSLMZRYLACIA-UHFFFAOYSA-N
SMILESC1=CC2=CN=C(N2C(=C1)Cl)C(=O)O

Computed by PubChem (NCBI)