CAS 1545675-72-6 is the registry number for 5-Chloroimidazo[1,5-a]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloroimidazo[1,5-a]pyridine-3-carboxylic acid (CAS 1545675-72-6) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 5-chloroimidazo[1,5-a]pyridine-3-carboxylic acid. InChIKey: MPGSLMZRYLACIA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 5-chloroimidazo[1,5-a]pyridine-3-carboxylic acid |
| InChIKey | MPGSLMZRYLACIA-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(N2C(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)