Products 1546250-12-7
CAS 1546250-12-7 is the registry number for 6,8-Dichloro-2-(o-tolyl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-2-(2-methylphenyl)imidazo[1,2-a]pyridine (CAS 1546250-12-7) is a chemical compound with the molecular formula C14H10Cl2N2 and a molecular weight of 277.1 g/mol. IUPAC name: 6,8-dichloro-2-(2-methylphenyl)imidazo[1,2-a]pyridine. InChIKey: OJTRJIFJQKHXDL-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N2 |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | 6,8-dichloro-2-(2-methylphenyl)imidazo[1,2-a]pyridine |
| InChIKey | OJTRJIFJQKHXDL-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CN3C=C(C=C(C3=N2)Cl)Cl |
Computed by PubChem (NCBI)