CAS 6971-97-7 appears in our catalog under these names: DCB, DCB, 98%, 98%, DCB, 98.81%. Offered by: TRC, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg, 200mg, 1mg, 5 mg.
(E)-1-(3-chlorophenyl)-N-[(E)-(3-chlorophenyl)methylideneamino]methanimine (CAS 6971-97-7) is a chemical compound with the molecular formula C14H10Cl2N2 and a molecular weight of 277.1 g/mol. IUPAC name: (E)-1-(3-chlorophenyl)-N-[(E)-(3-chlorophenyl)methylideneamino]methanimine. InChIKey: XMOVWXSCYLINBJ-BEQMOXJMSA-N.
| Molecular formula | C14H10Cl2N2 |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | (E)-1-(3-chlorophenyl)-N-[(E)-(3-chlorophenyl)methylideneamino]methanimine |
| InChIKey | XMOVWXSCYLINBJ-BEQMOXJMSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)/C=N/N=C/C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)