CAS 3510-48-3 appears in our catalog under these names: (E,E)-bis[(4-chlorophenyl)methylidene]hydrazine, 95%, N,N'-Bis(4-chlorobenzylidene)hydrazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2g, 10g.
(E)-1-(4-chlorophenyl)-N-[(E)-(4-chlorophenyl)methylideneamino]methanimine (CAS 3510-48-3) is a chemical compound with the molecular formula C14H10Cl2N2 and a molecular weight of 277.1 g/mol. IUPAC name: (E)-1-(4-chlorophenyl)-N-[(E)-(4-chlorophenyl)methylideneamino]methanimine. InChIKey: FDHFFSOZYINJQR-BEQMOXJMSA-N.
| Molecular formula | C14H10Cl2N2 |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | (E)-1-(4-chlorophenyl)-N-[(E)-(4-chlorophenyl)methylideneamino]methanimine |
| InChIKey | FDHFFSOZYINJQR-BEQMOXJMSA-N |
| SMILES | C1=CC(=CC=C1/C=N/N=C/C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)