CAS 15463-66-8 appears in our catalog under these names: 5-chloro-2-(2H-pyrazol-3-yl)aniline, 98%, 5-Chloro-2-(1H-pyrazol-5-yl)aniline, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
5-chloro-2-(1H-pyrazol-5-yl)aniline (CAS 15463-66-8) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 5-chloro-2-(1H-pyrazol-5-yl)aniline. InChIKey: HVRSBOGXTCMCGL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 5-chloro-2-(1H-pyrazol-5-yl)aniline |
| InChIKey | HVRSBOGXTCMCGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C2=CC=NN2 |
Computed by PubChem (NCBI)