CAS 1547-36-0 appears in our catalog under these names: 3,3-Bis(trifluoromethyl)-3-hydroxypropionic acid, 95%, 4,4,4-Trifluoro-3-hydroxy-3-(trifluoromethyl)butyric acid, 9. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid (CAS 1547-36-0) is a chemical compound with the molecular formula C5H4F6O3 and a molecular weight of 226.07 g/mol. IUPAC name: 4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid. InChIKey: NOHJBOWARMTILE-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid |
| InChIKey | NOHJBOWARMTILE-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)