CAS 607382-52-5 is the registry number for METHYL 2,2,2-TRIFLUORO-1-(TRIFLUOROMETH&. Offered by: Sigma-Aldrich. Available pack sizes: 25G.
1,1,1,3,3,3-hexafluoropropan-2-yl methyl carbonate (CAS 607382-52-5) is a chemical compound with the molecular formula C5H4F6O3 and a molecular weight of 226.07 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoropropan-2-yl methyl carbonate. InChIKey: XIRMSPZXBKNQNO-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoropropan-2-yl methyl carbonate |
| InChIKey | XIRMSPZXBKNQNO-UHFFFAOYSA-N |
| SMILES | COC(=O)OC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)