Products 607382-52-5

CAS 607382-52-5 is the registry number for METHYL 2,2,2-TRIFLUORO-1-(TRIFLUOROMETH&. Offered by: Sigma-Aldrich. Available pack sizes: 25G.

Structural formula: {0} (CAS {1})

1,1,1,3,3,3-hexafluoropropan-2-yl methyl carbonate (CAS 607382-52-5) is a chemical compound with the molecular formula C5H4F6O3 and a molecular weight of 226.07 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoropropan-2-yl methyl carbonate. InChIKey: XIRMSPZXBKNQNO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4F6O3
Molecular weight226.07 g/mol
IUPAC name1,1,1,3,3,3-hexafluoropropan-2-yl methyl carbonate
InChIKeyXIRMSPZXBKNQNO-UHFFFAOYSA-N
SMILESCOC(=O)OC(C(F)(F)F)C(F)(F)F

Computed by PubChem (NCBI)