CAS 154714-19-9 appears in our catalog under these names: 5-Hydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one, 5-Hydroxy-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 98%, 98%, 5-Hydroxy-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 98%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
5-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one (CAS 154714-19-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 5-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one. InChIKey: GCOZFWFNEBPOJF-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 5-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one |
| InChIKey | GCOZFWFNEBPOJF-UHFFFAOYSA-N |
| SMILES | CC1(OC2=CC=CC(=C2C(=O)O1)O)C |
Computed by PubChem (NCBI)