CAS 1547145-67-4 is the registry number for 4-Chloro-3,3-difluoroindolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3,3-difluoro-1H-indol-2-one (CAS 1547145-67-4) is a chemical compound with the molecular formula C8H4ClF2NO and a molecular weight of 203.57 g/mol. IUPAC name: 4-chloro-3,3-difluoro-1H-indol-2-one. InChIKey: LMWYYKAWCOKDTR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2NO |
|---|---|
| Molecular weight | 203.57 g/mol |
| IUPAC name | 4-chloro-3,3-difluoro-1H-indol-2-one |
| InChIKey | LMWYYKAWCOKDTR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(C(=O)N2)(F)F |
Computed by PubChem (NCBI)