CAS 197067-32-6 is the registry number for 5-Chloro-3,3-difluoro-2,3-dihydroindole-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
5-chloro-3,3-difluoro-1H-indol-2-one (CAS 197067-32-6) is a chemical compound with the molecular formula C8H4ClF2NO and a molecular weight of 203.57 g/mol. IUPAC name: 5-chloro-3,3-difluoro-1H-indol-2-one. InChIKey: PTVMNQPXBPQJJQ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2NO |
|---|---|
| Molecular weight | 203.57 g/mol |
| IUPAC name | 5-chloro-3,3-difluoro-1H-indol-2-one |
| InChIKey | PTVMNQPXBPQJJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(C(=O)N2)(F)F |
Computed by PubChem (NCBI)