CAS 212311-54-1 is the registry number for 2-(Chlorodifluoromethyl)-1,3-benzoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[chloro(difluoro)methyl]-1,3-benzoxazole (CAS 212311-54-1) is a chemical compound with the molecular formula C8H4ClF2NO and a molecular weight of 203.57 g/mol. IUPAC name: 2-[chloro(difluoro)methyl]-1,3-benzoxazole. InChIKey: NHSGLHULXBUSIQ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2NO |
|---|---|
| Molecular weight | 203.57 g/mol |
| IUPAC name | 2-[chloro(difluoro)methyl]-1,3-benzoxazole |
| InChIKey | NHSGLHULXBUSIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C(F)(F)Cl |
Computed by PubChem (NCBI)