Products 1547328-13-1
CAS 1547328-13-1 is the registry number for 5-Bromo-2-hydroxy-3-isopropylbenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-bromo-2-hydroxy-3-propan-2-ylbenzoic acid (CAS 1547328-13-1) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 5-bromo-2-hydroxy-3-propan-2-ylbenzoic acid. InChIKey: ZSFUXAHDYTUVQP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 5-bromo-2-hydroxy-3-propan-2-ylbenzoic acid |
| InChIKey | ZSFUXAHDYTUVQP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)Br)C(=O)O)O |
Computed by PubChem (NCBI)