Products 1547369-15-2
CAS 1547369-15-2 appears in our catalog under these names: 1-(2,2,2-trifluoroethyl)-1H-1,3-benzodiazole-4-carboxylic acid, 95%, 1-(2,2,2-Trifluoroethyl)-1H-benzo(d)imidazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxylic acid (CAS 1547369-15-2) is a chemical compound with the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxylic acid. InChIKey: RHGIDPNIUOPKKV-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O2 |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxylic acid |
| InChIKey | RHGIDPNIUOPKKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N(C=N2)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)