CAS 1956318-35-6 is the registry number for 1-Methyl-7-(trifluoromethyl)-1h-indazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-methyl-7-(trifluoromethyl)indazole-3-carboxylic acid (CAS 1956318-35-6) is a chemical compound with the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. IUPAC name: 1-methyl-7-(trifluoromethyl)indazole-3-carboxylic acid. InChIKey: IKBSGICSEAVIIL-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O2 |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | 1-methyl-7-(trifluoromethyl)indazole-3-carboxylic acid |
| InChIKey | IKBSGICSEAVIIL-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2C(F)(F)F)C(=N1)C(=O)O |
Computed by PubChem (NCBI)