Products 1956318-35-6

CAS 1956318-35-6 is the registry number for 1-Methyl-7-(trifluoromethyl)-1h-indazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-methyl-7-(trifluoromethyl)indazole-3-carboxylic acid (CAS 1956318-35-6) is a chemical compound with the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. IUPAC name: 1-methyl-7-(trifluoromethyl)indazole-3-carboxylic acid. InChIKey: IKBSGICSEAVIIL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3N2O2
Molecular weight244.17 g/mol
IUPAC name1-methyl-7-(trifluoromethyl)indazole-3-carboxylic acid
InChIKeyIKBSGICSEAVIIL-UHFFFAOYSA-N
SMILESCN1C2=C(C=CC=C2C(F)(F)F)C(=N1)C(=O)O

Computed by PubChem (NCBI)