CAS 1565779-83-0 is the registry number for 6-Methoxy-2-(trifluoromethyl)-1,5-naphthyridin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
6-methoxy-2-(trifluoromethyl)-1H-1,5-naphthyridin-4-one (CAS 1565779-83-0) is a chemical compound with the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. IUPAC name: 6-methoxy-2-(trifluoromethyl)-1H-1,5-naphthyridin-4-one. InChIKey: IRUQDJGDRZKDGI-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O2 |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | 6-methoxy-2-(trifluoromethyl)-1H-1,5-naphthyridin-4-one |
| InChIKey | IRUQDJGDRZKDGI-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)NC(=CC2=O)C(F)(F)F |
Computed by PubChem (NCBI)