CAS 1547626-25-4 is the registry number for 3-(2-Amino-6-chloro-1H-benzo[d]imidazol-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1-(1,1-dioxothiolan-3-yl)benzimidazol-2-amine (CAS 1547626-25-4) is a chemical compound with the molecular formula C11H12ClN3O2S and a molecular weight of 285.75 g/mol. IUPAC name: 6-chloro-1-(1,1-dioxothiolan-3-yl)benzimidazol-2-amine. InChIKey: VOJOIXFFGHERTL-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2S |
|---|---|
| Molecular weight | 285.75 g/mol |
| IUPAC name | 6-chloro-1-(1,1-dioxothiolan-3-yl)benzimidazol-2-amine |
| InChIKey | VOJOIXFFGHERTL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=CC(=C3)Cl)N=C2N |
Computed by PubChem (NCBI)