Products 2287344-87-8
CAS 2287344-87-8 is the registry number for 2-((5-Chloro-1H-benzo[d][1,2,3]triazol-1-yl)methyl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-chlorobenzotriazol-1-yl)methyl]thiolane 1,1-dioxide (CAS 2287344-87-8) is a chemical compound with the molecular formula C11H12ClN3O2S and a molecular weight of 285.75 g/mol. IUPAC name: 2-[(5-chlorobenzotriazol-1-yl)methyl]thiolane 1,1-dioxide. InChIKey: AIDIEYVKYHVRHL-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2S |
|---|---|
| Molecular weight | 285.75 g/mol |
| IUPAC name | 2-[(5-chlorobenzotriazol-1-yl)methyl]thiolane 1,1-dioxide |
| InChIKey | AIDIEYVKYHVRHL-UHFFFAOYSA-N |
| SMILES | C1CC(S(=O)(=O)C1)CN2C3=C(C=C(C=C3)Cl)N=N2 |
Computed by PubChem (NCBI)