Products 2287342-57-6

CAS 2287342-57-6 is the registry number for 4-(6-Chloro-1H-benzo[d][1,2,3]triazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(6-chlorobenzotriazol-1-yl)thiane 1,1-dioxide (CAS 2287342-57-6) is a chemical compound with the molecular formula C11H12ClN3O2S and a molecular weight of 285.75 g/mol. IUPAC name: 4-(6-chlorobenzotriazol-1-yl)thiane 1,1-dioxide. InChIKey: NJEYFLUODZBXCX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClN3O2S
Molecular weight285.75 g/mol
IUPAC name4-(6-chlorobenzotriazol-1-yl)thiane 1,1-dioxide
InChIKeyNJEYFLUODZBXCX-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCC1N2C3=C(C=CC(=C3)Cl)N=N2

Computed by PubChem (NCBI)