Products 1547742-37-9
CAS 1547742-37-9 is the registry number for 6-Fluorobenzo[d][1,3]dioxole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-1,3-benzodioxole-5-carboxylic acid (CAS 1547742-37-9) is a chemical compound with the molecular formula C8H5FO4 and a molecular weight of 184.12 g/mol. IUPAC name: 6-fluoro-1,3-benzodioxole-5-carboxylic acid. InChIKey: GRTXIGVHMDIGTI-UHFFFAOYSA-N.
| Molecular formula | C8H5FO4 |
|---|---|
| Molecular weight | 184.12 g/mol |
| IUPAC name | 6-fluoro-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | GRTXIGVHMDIGTI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)F |
Computed by PubChem (NCBI)