CAS 1583-67-1 appears in our catalog under these names: 3–Fluorophthalic acid, 3-Fluorophthalic acid/ 97%, 3-Fluorophthalic acid, 97% , 3-Fluorophthalic Acid, >98.0%(GC)(T), 3-Fluorophthalic acid 97%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
3-fluorophthalic acid (CAS 1583-67-1) is a chemical compound with the molecular formula C8H5FO4 and a molecular weight of 184.12 g/mol. IUPAC name: 3-fluorophthalic acid. InChIKey: BBCQSMSCEJBIRD-UHFFFAOYSA-N.
| Molecular formula | C8H5FO4 |
|---|---|
| Molecular weight | 184.12 g/mol |
| IUPAC name | 3-fluorophthalic acid |
| InChIKey | BBCQSMSCEJBIRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)