CAS 327-95-7 appears in our catalog under these names: 4-Fluorobenzene-1,3-dicarboxylic acid, 97%, 4–Fluoroisophthalic acid, 4-Fluoroisophthalic acid 97%, 4-fluoroisophthalic acid, 98%, 98%, 4-Fluorobenzene-1,3-dicarboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg, 100 mg.
4-fluorobenzene-1,3-dicarboxylic acid (CAS 327-95-7) is a chemical compound with the molecular formula C8H5FO4 and a molecular weight of 184.12 g/mol. IUPAC name: 4-fluorobenzene-1,3-dicarboxylic acid. InChIKey: OPWLKVOLSUNGEI-UHFFFAOYSA-N.
| Molecular formula | C8H5FO4 |
|---|---|
| Molecular weight | 184.12 g/mol |
| IUPAC name | 4-fluorobenzene-1,3-dicarboxylic acid |
| InChIKey | OPWLKVOLSUNGEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)F |
Computed by PubChem (NCBI)