Products 1548425-13-3

CAS 1548425-13-3 is the registry number for 2-(2-Bromophenyl)-2-cyclohexylacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2-bromophenyl)-2-cyclohexylacetic acid (CAS 1548425-13-3) is a chemical compound with the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. IUPAC name: 2-(2-bromophenyl)-2-cyclohexylacetic acid. InChIKey: DOLDFPQXWAZTAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17BrO2
Molecular weight297.19 g/mol
IUPAC name2-(2-bromophenyl)-2-cyclohexylacetic acid
InChIKeyDOLDFPQXWAZTAJ-UHFFFAOYSA-N
SMILESC1CCC(CC1)C(C2=CC=CC=C2Br)C(=O)O

Computed by PubChem (NCBI)