CAS 345965-53-9 appears in our catalog under these names: 1-(4-Bromo-phenyl)-cyclopropanecarboxylic acid tert-butyl ester, 95%, tert-Butyl 1-(4-bromophenyl)cyclopropanecarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 1-(4-bromophenyl)cyclopropane-1-carboxylate (CAS 345965-53-9) is a chemical compound with the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. IUPAC name: tert-butyl 1-(4-bromophenyl)cyclopropane-1-carboxylate. InChIKey: OCIDCJXKYGNZCU-UHFFFAOYSA-N.
| Molecular formula | C14H17BrO2 |
|---|---|
| Molecular weight | 297.19 g/mol |
| IUPAC name | tert-butyl 1-(4-bromophenyl)cyclopropane-1-carboxylate |
| InChIKey | OCIDCJXKYGNZCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1(CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)