Products 76618-93-4
CAS 76618-93-4 is the registry number for 2-(4-Bromophenyl)-2-cyclohexylacetic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(4-bromophenyl)-2-cyclohexylacetic acid (CAS 76618-93-4) is a chemical compound with the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. IUPAC name: 2-(4-bromophenyl)-2-cyclohexylacetic acid. InChIKey: OUBRRBKLVRLNBH-UHFFFAOYSA-N.
| Molecular formula | C14H17BrO2 |
|---|---|
| Molecular weight | 297.19 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-cyclohexylacetic acid |
| InChIKey | OUBRRBKLVRLNBH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)