Products 1548668-40-1
CAS 1548668-40-1 is the registry number for ethyl 4-(4-bromo-2-fluorophenyl)thiazole-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4-(4-bromo-2-fluorophenyl)-1,3-thiazole-2-carboxylate (CAS 1548668-40-1) is a chemical compound with the molecular formula C12H9BrFNO2S and a molecular weight of 330.17 g/mol. IUPAC name: ethyl 4-(4-bromo-2-fluorophenyl)-1,3-thiazole-2-carboxylate. InChIKey: HADLIGBJVAAKAC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrFNO2S |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | ethyl 4-(4-bromo-2-fluorophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | HADLIGBJVAAKAC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)