CAS 519017-71-1 is the registry number for N-(4-Bromo-2-fluorophenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-(4-bromo-2-fluorophenyl)benzenesulfonamide (CAS 519017-71-1) is a chemical compound with the molecular formula C12H9BrFNO2S and a molecular weight of 330.17 g/mol. IUPAC name: N-(4-bromo-2-fluorophenyl)benzenesulfonamide. InChIKey: VCLXTMXWAZHPJP-UHFFFAOYSA-N.
| Molecular formula | C12H9BrFNO2S |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | N-(4-bromo-2-fluorophenyl)benzenesulfonamide |
| InChIKey | VCLXTMXWAZHPJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)