Products 851215-82-2
CAS 851215-82-2 is the registry number for 2-Bromo-N-(3-fluorophenyl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(3-fluorophenyl)benzenesulfonamide (CAS 851215-82-2) is a chemical compound with the molecular formula C12H9BrFNO2S and a molecular weight of 330.17 g/mol. IUPAC name: 2-bromo-N-(3-fluorophenyl)benzenesulfonamide. InChIKey: NKJCKUUNHKBWAO-UHFFFAOYSA-N.
| Molecular formula | C12H9BrFNO2S |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-bromo-N-(3-fluorophenyl)benzenesulfonamide |
| InChIKey | NKJCKUUNHKBWAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)NC2=CC(=CC=C2)F)Br |
Computed by PubChem (NCBI)