CAS 154869-00-8 is the registry number for 2,3-Dimethoxy-11h-indeno[1,2-b]quinoline-10-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3-dimethoxy-11H-indeno[1,2-b]quinoline-10-carboxylic acid (CAS 154869-00-8) is a chemical compound with the molecular formula C19H15NO4 and a molecular weight of 321.3 g/mol. IUPAC name: 2,3-dimethoxy-11H-indeno[1,2-b]quinoline-10-carboxylic acid. InChIKey: ZEDLSMFUNOJCLH-UHFFFAOYSA-N.
| Molecular formula | C19H15NO4 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 2,3-dimethoxy-11H-indeno[1,2-b]quinoline-10-carboxylic acid |
| InChIKey | ZEDLSMFUNOJCLH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC3=C(C4=CC=CC=C4N=C32)C(=O)O)OC |
Computed by PubChem (NCBI)