Products 154869-00-8

CAS 154869-00-8 is the registry number for 2,3-Dimethoxy-11h-indeno[1,2-b]quinoline-10-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2,3-dimethoxy-11H-indeno[1,2-b]quinoline-10-carboxylic acid (CAS 154869-00-8) is a chemical compound with the molecular formula C19H15NO4 and a molecular weight of 321.3 g/mol. IUPAC name: 2,3-dimethoxy-11H-indeno[1,2-b]quinoline-10-carboxylic acid. InChIKey: ZEDLSMFUNOJCLH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15NO4
Molecular weight321.3 g/mol
IUPAC name2,3-dimethoxy-11H-indeno[1,2-b]quinoline-10-carboxylic acid
InChIKeyZEDLSMFUNOJCLH-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)CC3=C(C4=CC=CC=C4N=C32)C(=O)O)OC

Computed by PubChem (NCBI)