Products 69160-56-1
CAS 69160-56-1 is the registry number for cis-1-Phenyl-2-(phthalimidomethyl)cyclopropanecarboxylic Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.
2-[(1,3-dioxoisoindol-2-yl)methyl]-1-phenylcyclopropane-1-carboxylic acid (CAS 69160-56-1) is a chemical compound with the molecular formula C19H15NO4 and a molecular weight of 321.3 g/mol. IUPAC name: 2-[(1,3-dioxoisoindol-2-yl)methyl]-1-phenylcyclopropane-1-carboxylic acid. InChIKey: XWJCCJTWOLBUSW-UHFFFAOYSA-N.
| Molecular formula | C19H15NO4 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-1-phenylcyclopropane-1-carboxylic acid |
| InChIKey | XWJCCJTWOLBUSW-UHFFFAOYSA-N |
| SMILES | C1C(C1(C2=CC=CC=C2)C(=O)O)CN3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)