Products 94301-28-7

CAS 94301-28-7 is the registry number for 2,6-Dimethyl-4-(1-naphthyl)pyridine-3,5-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,6-dimethyl-4-naphthalen-1-ylpyridine-3,5-dicarboxylic acid (CAS 94301-28-7) is a chemical compound with the molecular formula C19H15NO4 and a molecular weight of 321.3 g/mol. IUPAC name: 2,6-dimethyl-4-naphthalen-1-ylpyridine-3,5-dicarboxylic acid. InChIKey: RLBKMEZFXODUAS-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15NO4
Molecular weight321.3 g/mol
IUPAC name2,6-dimethyl-4-naphthalen-1-ylpyridine-3,5-dicarboxylic acid
InChIKeyRLBKMEZFXODUAS-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=N1)C)C(=O)O)C2=CC=CC3=CC=CC=C32)C(=O)O

Computed by PubChem (NCBI)