CAS 94301-28-7 is the registry number for 2,6-Dimethyl-4-(1-naphthyl)pyridine-3,5-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,6-dimethyl-4-naphthalen-1-ylpyridine-3,5-dicarboxylic acid (CAS 94301-28-7) is a chemical compound with the molecular formula C19H15NO4 and a molecular weight of 321.3 g/mol. IUPAC name: 2,6-dimethyl-4-naphthalen-1-ylpyridine-3,5-dicarboxylic acid. InChIKey: RLBKMEZFXODUAS-UHFFFAOYSA-N.
| Molecular formula | C19H15NO4 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 2,6-dimethyl-4-naphthalen-1-ylpyridine-3,5-dicarboxylic acid |
| InChIKey | RLBKMEZFXODUAS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)O)C2=CC=CC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)