Products 154877-92-6
CAS 154877-92-6 appears in our catalog under these names: Pitavastatin Impurity 74, Rosuvastatin impurity 42. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5000mg, 1000mg.
2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CAS 154877-92-6) is a chemical compound with the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. IUPAC name: 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid. InChIKey: FNKPNKOHCXKXCK-RQJHMYQMSA-N.
| Molecular formula | C9H16O5 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| InChIKey | FNKPNKOHCXKXCK-RQJHMYQMSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CO)CC(=O)O)C |
Computed by PubChem (NCBI)