Products 154953-94-3
CAS 154953-94-3 is the registry number for 2-(4,5-Dimethoxy-2-nitrophenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,5-dimethoxy-2-nitrophenyl)indene-1,3-dione (CAS 154953-94-3) is a chemical compound with the molecular formula C17H13NO6 and a molecular weight of 327.29 g/mol. IUPAC name: 2-(4,5-dimethoxy-2-nitrophenyl)indene-1,3-dione. InChIKey: KMUCRCOBGVTQEX-UHFFFAOYSA-N.
| Molecular formula | C17H13NO6 |
|---|---|
| Molecular weight | 327.29 g/mol |
| IUPAC name | 2-(4,5-dimethoxy-2-nitrophenyl)indene-1,3-dione |
| InChIKey | KMUCRCOBGVTQEX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C2C(=O)C3=CC=CC=C3C2=O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)