Products 2651958-72-2

CAS 2651958-72-2 is the registry number for (E)-4-(3-(4-Methoxy-3-nitrophenyl)-3-oxoprop-1-en-1-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(E)-3-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-enyl]benzoic acid (CAS 2651958-72-2) is a chemical compound with the molecular formula C17H13NO6 and a molecular weight of 327.29 g/mol. IUPAC name: 4-[(E)-3-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-enyl]benzoic acid. InChIKey: LRHUXBQHFYKRMD-XBXARRHUSA-N.

Identity
Molecular formulaC17H13NO6
Molecular weight327.29 g/mol
IUPAC name4-[(E)-3-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-enyl]benzoic acid
InChIKeyLRHUXBQHFYKRMD-XBXARRHUSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)