CAS 356578-82-0 appears in our catalog under these names: 2-(2,4-Dimethoxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(2,4-Dimethoxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,4-dimethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 356578-82-0) is a chemical compound with the molecular formula C17H13NO6 and a molecular weight of 327.29 g/mol. IUPAC name: 2-(2,4-dimethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: NWRPRCMEFWOWDJ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO6 |
|---|---|
| Molecular weight | 327.29 g/mol |
| IUPAC name | 2-(2,4-dimethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | NWRPRCMEFWOWDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)OC |
Computed by PubChem (NCBI)