Products 1549588-60-4

CAS 1549588-60-4 is the registry number for 2-(3-Bromo-4-fluorophenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-bromo-4-fluorophenoxy)propanoic acid (CAS 1549588-60-4) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: 2-(3-bromo-4-fluorophenoxy)propanoic acid. InChIKey: IDCNZNPQCJFYSC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrFO3
Molecular weight263.06 g/mol
IUPAC name2-(3-bromo-4-fluorophenoxy)propanoic acid
InChIKeyIDCNZNPQCJFYSC-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=CC(=C(C=C1)F)Br

Computed by PubChem (NCBI)