CAS 1550-27-2 appears in our catalog under these names: 2-Nitro-4-(trifluoromethylsulfonyl)chlorobenzene, 95%, 1-Chloro-2-nitro-4-((trifluoromethyl)sulfonyl)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
1-chloro-2-nitro-4-(trifluoromethylsulfonyl)benzene (CAS 1550-27-2) is a chemical compound with the molecular formula C7H3ClF3NO4S and a molecular weight of 289.62 g/mol. IUPAC name: 1-chloro-2-nitro-4-(trifluoromethylsulfonyl)benzene. InChIKey: BDIMBZRJVHLTPD-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO4S |
|---|---|
| Molecular weight | 289.62 g/mol |
| IUPAC name | 1-chloro-2-nitro-4-(trifluoromethylsulfonyl)benzene |
| InChIKey | BDIMBZRJVHLTPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)C(F)(F)F)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)