Products 444-46-2

CAS 444-46-2 appears in our catalog under these names: 4-Nitro-2-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%, 98%, 4-Nitro-2-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-nitro-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 444-46-2) is a chemical compound with the molecular formula C7H3ClF3NO4S and a molecular weight of 289.62 g/mol. IUPAC name: 4-nitro-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: ICROHEDUOASYFB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF3NO4S
Molecular weight289.62 g/mol
IUPAC name4-nitro-2-(trifluoromethyl)benzenesulfonyl chloride
InChIKeyICROHEDUOASYFB-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)