CAS 444-46-2 appears in our catalog under these names: 4-Nitro-2-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%, 98%, 4-Nitro-2-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-nitro-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 444-46-2) is a chemical compound with the molecular formula C7H3ClF3NO4S and a molecular weight of 289.62 g/mol. IUPAC name: 4-nitro-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: ICROHEDUOASYFB-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO4S |
|---|---|
| Molecular weight | 289.62 g/mol |
| IUPAC name | 4-nitro-2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | ICROHEDUOASYFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)