CAS 39234-83-8 appears in our catalog under these names: 4-Nitro-3-(trifluoromethyl)benzenesulfonyl chloride, 95%, 4-Nitro-3-(trifluoromethyl)benzenesulfonyl chloride, 97% , 4-Nitro-3-(trifluoromethyl)benzenesulfonyl chloride 95%, 4-Nitro-3-(trifluoromethyl)benzenesulfonylchloride, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
4-nitro-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 39234-83-8) is a chemical compound with the molecular formula C7H3ClF3NO4S and a molecular weight of 289.62 g/mol. IUPAC name: 4-nitro-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: LJQUNSRHHHYXEW-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO4S |
|---|---|
| Molecular weight | 289.62 g/mol |
| IUPAC name | 4-nitro-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | LJQUNSRHHHYXEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)