Products 155112-92-8
CAS 155112-92-8 appears in our catalog under these names: Woodorien, ≥98%, ≥98%, Woodorien. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 20mg, 50mg, 100mg, Get quote.
Methyl 4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate (CAS 155112-92-8) is a chemical compound with the molecular formula C14H18O9 and a molecular weight of 330.29 g/mol. IUPAC name: methyl 4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate. InChIKey: PXDASGXIBCEXNH-YGEZULPYSA-N.
| Molecular formula | C14H18O9 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | methyl 4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
| InChIKey | PXDASGXIBCEXNH-YGEZULPYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)