CAS 53827-68-2 appears in our catalog under these names: 3–(β–D–Glucopyranosyloxy)–2–hydroxybenzoic acid methyl ester, 3-(Beta-D-glucopyranosyloxy)-2-hydroxybenzoic acid methyl ester, 3-(β-D-Glucopyranosyloxy)-2-hydroxybenzoic acid methyl ester. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, Get quote.
Methyl 2-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate (CAS 53827-68-2) is a chemical compound with the molecular formula C14H18O9 and a molecular weight of 330.29 g/mol. IUPAC name: methyl 2-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate. InChIKey: VSTYNZNDJYVPKL-RRZLQCMWSA-N.
| Molecular formula | C14H18O9 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | methyl 2-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate |
| InChIKey | VSTYNZNDJYVPKL-RRZLQCMWSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O |
Computed by PubChem (NCBI)