CAS 172377-87-6 appears in our catalog under these names: 2–Hydroxy–3–methoxybenzoic acid glucose ester, 2-Hydroxy-3-methoxybenzoic acid glucose ester. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-hydroxy-3-methoxybenzoate (CAS 172377-87-6) is a chemical compound with the molecular formula C14H18O9 and a molecular weight of 330.29 g/mol. IUPAC name: [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-hydroxy-3-methoxybenzoate. InChIKey: AKQPDLWSZUWOPL-CGUBKOMSSA-N.
| Molecular formula | C14H18O9 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-hydroxy-3-methoxybenzoate |
| InChIKey | AKQPDLWSZUWOPL-CGUBKOMSSA-N |
| SMILES | COC1=CC=CC(=C1O)C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)