Products 1551131-41-9
CAS 1551131-41-9 appears in our catalog under these names: 2-(1-Cyano-2-methylbutyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(1-Cyano-2-methylbutyl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(1-cyano-2-methylbutyl)-1,3-thiazole-4-carboxylic acid (CAS 1551131-41-9) is a chemical compound with the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. IUPAC name: 2-(1-cyano-2-methylbutyl)-1,3-thiazole-4-carboxylic acid. InChIKey: GKFXGKIBVFDKBP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 2-(1-cyano-2-methylbutyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | GKFXGKIBVFDKBP-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C#N)C1=NC(=CS1)C(=O)O |
Computed by PubChem (NCBI)