CAS 15516-60-6 is the registry number for 2-hydroxy-5-nitrosobenzoic acid. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitrososalicylic acid is a hydroxybenzoic acid. It is functionally related to a salicylic acid.
Source: ChEBI
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 2-hydroxy-5-nitrosobenzoic acid |
| InChIKey | UNQLIDLZZNHURS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=O)C(=O)O)O |
Computed by PubChem (NCBI)