CAS 15519-73-0 appears in our catalog under these names: 5,5'-dimethyl-(1,1'-biphenyl)-2,2'-diol, Gastrodin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-hydroxy-5-methylphenyl)-4-methylphenol (CAS 15519-73-0) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: 2-(2-hydroxy-5-methylphenyl)-4-methylphenol. InChIKey: JIONXXHMDHBECT-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 2-(2-hydroxy-5-methylphenyl)-4-methylphenol |
| InChIKey | JIONXXHMDHBECT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)C)O |
Computed by PubChem (NCBI)