Products 155321-96-3
CAS 155321-96-3 appears in our catalog under these names: Solpecainol/ 100%, Solpecainol. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
(1S,2R)-2-[[(2R)-1-phenoxypropan-2-yl]amino]-1-phenylpropane-1,3-diol (CAS 155321-96-3) is a chemical compound with the molecular formula C18H23NO3 and a molecular weight of 301.4 g/mol. IUPAC name: (1S,2R)-2-[[(2R)-1-phenoxypropan-2-yl]amino]-1-phenylpropane-1,3-diol. InChIKey: DQAFKLGCFBLEOM-OLMNPRSZSA-N.
| Molecular formula | C18H23NO3 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | (1S,2R)-2-[[(2R)-1-phenoxypropan-2-yl]amino]-1-phenylpropane-1,3-diol |
| InChIKey | DQAFKLGCFBLEOM-OLMNPRSZSA-N |
| SMILES | C[C@H](COC1=CC=CC=C1)N[C@H](CO)[C@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)