CAS 1553225-70-9 is the registry number for Methyl 4-Hydroxy-2-methyl-1H-indole-6-carboxylate. Offered by: TRC. Available pack sizes: 500mg.
Methyl 4-hydroxy-2-methyl-1H-indole-6-carboxylate (CAS 1553225-70-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 4-hydroxy-2-methyl-1H-indole-6-carboxylate. InChIKey: VJNJUIVXCXKQIZ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 4-hydroxy-2-methyl-1H-indole-6-carboxylate |
| InChIKey | VJNJUIVXCXKQIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=C(C=C2O)C(=O)OC |
Computed by PubChem (NCBI)