Products 1554029-87-6
CAS 1554029-87-6 is the registry number for 5-(1,1-Difluoroethyl)-2-fluorobenzoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(1,1-difluoroethyl)-2-fluorobenzoic acid (CAS 1554029-87-6) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 5-(1,1-difluoroethyl)-2-fluorobenzoic acid. InChIKey: TUJWAZJEAZLOSC-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 5-(1,1-difluoroethyl)-2-fluorobenzoic acid |
| InChIKey | TUJWAZJEAZLOSC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)F)C(=O)O)(F)F |
Computed by PubChem (NCBI)